About N-(1,3-dioxolan-2-ylmethyl)-2,4-dimethylcyclohexan-1-amine
N-(1,3-dioxolan-2-ylmethyl)-2,4-dimethylcyclohexan-1-amine (PubChem CID 131175670) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is N-(1,3-dioxolan-2-ylmethyl)-2,4-dimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | N-(1,3-dioxolan-2-ylmethyl)-2,4-dimethylcyclohexan-1-amine |
| PubChem CID | 131175670 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-(1,3-dioxolan-2-ylmethyl)-2,4-dimethylcyclohexan-1-amine |
| SMILES | CC1CCC(NCC2OCCO2)C(C)C1 |
| InChI | InChI=1S/C12H23NO2/c1-9-3-4-11(10(2)7-9)13-8-12-14-5-6-15-12/h9-13H,3-8H2,1-2H3 |
| InChIKey | ZVJWWEIZVCRMIJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1,3-dioxolan-2-ylmethyl)-2,4-dimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dioxolan-2-ylmethyl)-2,4-dimethylcyclohexan-1-amine?
The IUPAC name of N-(1,3-dioxolan-2-ylmethyl)-2,4-dimethylcyclohexan-1-amine (CID 131175670) is N-(1,3-dioxolan-2-ylmethyl)-2,4-dimethylcyclohexan-1-amine.
What is the SMILES notation for N-(1,3-dioxolan-2-ylmethyl)-2,4-dimethylcyclohexan-1-amine?
The canonical SMILES for N-(1,3-dioxolan-2-ylmethyl)-2,4-dimethylcyclohexan-1-amine is CC1CCC(NCC2OCCO2)C(C)C1.
What is the InChIKey of N-(1,3-dioxolan-2-ylmethyl)-2,4-dimethylcyclohexan-1-amine?
The InChIKey is ZVJWWEIZVCRMIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-9-3-4-11(10(2)7-9)13-8-12-14-5-6-15-12/h9-13H,3-8H2,1-2H3.
What are the key properties of N-(1,3-dioxolan-2-ylmethyl)-2,4-dimethylcyclohexan-1-amine?
N-(1,3-dioxolan-2-ylmethyl)-2,4-dimethylcyclohexan-1-amine has a molecular weight of 213.32 g/mol, XLogP of 1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dioxolan-2-ylmethyl)-2,4-dimethylcyclohexan-1-amine is sourced from PubChem (CID 131175670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).