About [3-fluoro-1-(1,2,4-thiadiazol-5-yl)pyrrolidin-3-yl]methanol
[3-fluoro-1-(1,2,4-thiadiazol-5-yl)pyrrolidin-3-yl]methanol (PubChem CID 131176737) has the molecular formula C7H10FN3OS
and a molecular weight of 203.24 g/mol. Its IUPAC name is [3-fluoro-1-(1,2,4-thiadiazol-5-yl)pyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [3-fluoro-1-(1,2,4-thiadiazol-5-yl)pyrrolidin-3-yl]methanol |
| PubChem CID | 131176737 |
| Molecular Formula | C7H10FN3OS |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | [3-fluoro-1-(1,2,4-thiadiazol-5-yl)pyrrolidin-3-yl]methanol |
| SMILES | OCC1(F)CCN(c2ncns2)C1 |
| InChI | InChI=1S/C7H10FN3OS/c8-7(4-12)1-2-11(3-7)6-9-5-10-13-6/h5,12H,1-4H2 |
| InChIKey | LLRZQSNZTKGEFD-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-fluoro-1-(1,2,4-thiadiazol-5-yl)pyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-1-(1,2,4-thiadiazol-5-yl)pyrrolidin-3-yl]methanol?
The IUPAC name of [3-fluoro-1-(1,2,4-thiadiazol-5-yl)pyrrolidin-3-yl]methanol (CID 131176737) is [3-fluoro-1-(1,2,4-thiadiazol-5-yl)pyrrolidin-3-yl]methanol.
What is the SMILES notation for [3-fluoro-1-(1,2,4-thiadiazol-5-yl)pyrrolidin-3-yl]methanol?
The canonical SMILES for [3-fluoro-1-(1,2,4-thiadiazol-5-yl)pyrrolidin-3-yl]methanol is OCC1(F)CCN(c2ncns2)C1.
What is the InChIKey of [3-fluoro-1-(1,2,4-thiadiazol-5-yl)pyrrolidin-3-yl]methanol?
The InChIKey is LLRZQSNZTKGEFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10FN3OS/c8-7(4-12)1-2-11(3-7)6-9-5-10-13-6/h5,12H,1-4H2.
What are the key properties of [3-fluoro-1-(1,2,4-thiadiazol-5-yl)pyrrolidin-3-yl]methanol?
[3-fluoro-1-(1,2,4-thiadiazol-5-yl)pyrrolidin-3-yl]methanol has a molecular weight of 203.24 g/mol, XLogP of 0.45, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-1-(1,2,4-thiadiazol-5-yl)pyrrolidin-3-yl]methanol is sourced from PubChem (CID 131176737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).