C9H15NO3 — CID 131176950
2-hydroxy-1-(1-oxa-6-azaspiro[3.3]heptan-6-yl)butan-1-one (PubChem CID 131176950) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 2-hydroxy-1-(1-oxa-6-azaspiro[3.3]heptan-6-yl)butan-1-one.
| Compound Name | 2-hydroxy-1-(1-oxa-6-azaspiro[3.3]heptan-6-yl)butan-1-one |
|---|---|
| PubChem CID | 131176950 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 2-hydroxy-1-(1-oxa-6-azaspiro[3.3]heptan-6-yl)butan-1-one |
| SMILES | CCC(O)C(=O)N1CC2(CCO2)C1 |
| InChI | InChI=1S/C9H15NO3/c1-2-7(11)8(12)10-5-9(6-10)3-4-13-9/h7,11H,2-6H2,1H3 |
| InChIKey | VUOAOWWPVNDSAF-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |