C8H16O2 — CID 131177200
(1R,3R,4R,6R)-4,6-dimethylcyclohexane-1,3-diol (PubChem CID 131177200) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is (1R,3R,4R,6R)-4,6-dimethylcyclohexane-1,3-diol.
| Compound Name | (1R,3R,4R,6R)-4,6-dimethylcyclohexane-1,3-diol |
|---|---|
| PubChem CID | 131177200 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | (1R,3R,4R,6R)-4,6-dimethylcyclohexane-1,3-diol |
| SMILES | C[C@@H]1C[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C8H16O2/c1-5-3-6(2)8(10)4-7(5)9/h5-10H,3-4H2,1-2H3/t5-,6-,7-,8-/m1/s1 |
| InChIKey | WGXSWJYIAWIGBQ-WCTZXXKLSA-N |
| XLogP | 0.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |