C11H18O3 — CID 131177950
methyl (1R,2S,3R,5R)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclopentane-1-carboxylate (PubChem CID 131177950) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is methyl (1R,2S,3R,5R)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2S,3R,5R)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 131177950 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | methyl (1R,2S,3R,5R)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclopentane-1-carboxylate |
| SMILES | C=C(C)[C@@H]1C[C@@H](O)[C@@H](C)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C11H18O3/c1-6(2)8-5-9(12)7(3)10(8)11(13)14-4/h7-10,12H,1,5H2,2-4H3/t7-,8+,9-,10+/m1/s1 |
| InChIKey | MXWDLRSHYAGBPR-RGOKHQFPSA-N |
| XLogP | 1.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|