C24H23ClN2O4S — CID 1311794
N-(3-acetylphenyl)-2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]acetamide (PubChem CID 1311794) has the molecular formula C24H23ClN2O4S and a molecular weight of 470.98 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
|---|---|
| PubChem CID | 1311794 |
| Molecular Formula | C24H23ClN2O4S |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | N-(3-acetylphenyl)-2-[(4-chlorophenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CN(CCc2ccccc2)S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H23ClN2O4S/c1-18(28)20-8-5-9-22(16-20)26-24(29)17-27(15-14-19-6-3-2-4-7-19)32(30,31)23-12-10-21(25)11-13-23/h2-13,16H,14-15,17H2,1H3,(H,26,29) |
| InChIKey | VBCKGYSIANSPLF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |