About (6R)-5,5-difluoro-6-(hydroxymethyl)-2,6-dihydropyran-2-ol
(6R)-5,5-difluoro-6-(hydroxymethyl)-2,6-dihydropyran-2-ol (PubChem CID 131180664) has the molecular formula C6H8F2O3
and a molecular weight of 166.12 g/mol. Its IUPAC name is (6R)-5,5-difluoro-6-(hydroxymethyl)-2,6-dihydropyran-2-ol.
Molecular Properties
| Compound Name | (6R)-5,5-difluoro-6-(hydroxymethyl)-2,6-dihydropyran-2-ol |
| PubChem CID | 131180664 |
| Molecular Formula | C6H8F2O3 |
| Molecular Weight | 166.12 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | (6R)-5,5-difluoro-6-(hydroxymethyl)-2,6-dihydropyran-2-ol |
| SMILES | OC[C@H]1OC(O)C=CC1(F)F |
| InChI | InChI=1S/C6H8F2O3/c7-6(8)2-1-5(10)11-4(6)3-9/h1-2,4-5,9-10H,3H2/t4-,5?/m1/s1 |
| InChIKey | XBGVZTFJBISICG-CNZKWPKMSA-N |
| XLogP | -0.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.12 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6R)-5,5-difluoro-6-(hydroxymethyl)-2,6-dihydropyran-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-5,5-difluoro-6-(hydroxymethyl)-2,6-dihydropyran-2-ol?
The IUPAC name of (6R)-5,5-difluoro-6-(hydroxymethyl)-2,6-dihydropyran-2-ol (CID 131180664) is (6R)-5,5-difluoro-6-(hydroxymethyl)-2,6-dihydropyran-2-ol.
What is the SMILES notation for (6R)-5,5-difluoro-6-(hydroxymethyl)-2,6-dihydropyran-2-ol?
The canonical SMILES for (6R)-5,5-difluoro-6-(hydroxymethyl)-2,6-dihydropyran-2-ol is OC[C@H]1OC(O)C=CC1(F)F.
What is the InChIKey of (6R)-5,5-difluoro-6-(hydroxymethyl)-2,6-dihydropyran-2-ol?
The InChIKey is XBGVZTFJBISICG-CNZKWPKMSA-N. The full InChI is InChI=1S/C6H8F2O3/c7-6(8)2-1-5(10)11-4(6)3-9/h1-2,4-5,9-10H,3H2/t4-,5?/m1/s1.
What are the key properties of (6R)-5,5-difluoro-6-(hydroxymethyl)-2,6-dihydropyran-2-ol?
(6R)-5,5-difluoro-6-(hydroxymethyl)-2,6-dihydropyran-2-ol has a molecular weight of 166.12 g/mol, XLogP of -0.11, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-5,5-difluoro-6-(hydroxymethyl)-2,6-dihydropyran-2-ol is sourced from PubChem (CID 131180664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).