About 5-chloro-2-ethylpentanal
5-chloro-2-ethylpentanal (PubChem CID 13118181) has the molecular formula C7H13ClO
and a molecular weight of 148.63 g/mol. Its IUPAC name is 5-chloro-2-ethylpentanal.
Molecular Properties
| Compound Name | 5-chloro-2-ethylpentanal |
| PubChem CID | 13118181 |
| Molecular Formula | C7H13ClO |
| Molecular Weight | 148.63 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 5-chloro-2-ethylpentanal |
| SMILES | CCC(C=O)CCCCl |
| InChI | InChI=1S/C7H13ClO/c1-2-7(6-9)4-3-5-8/h6-7H,2-5H2,1H3 |
| InChIKey | NGQQRRPIPBXQQI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.63 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-ethylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-ethylpentanal?
The IUPAC name of 5-chloro-2-ethylpentanal (CID 13118181) is 5-chloro-2-ethylpentanal.
What is the SMILES notation for 5-chloro-2-ethylpentanal?
The canonical SMILES for 5-chloro-2-ethylpentanal is CCC(C=O)CCCCl.
What is the InChIKey of 5-chloro-2-ethylpentanal?
The InChIKey is NGQQRRPIPBXQQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClO/c1-2-7(6-9)4-3-5-8/h6-7H,2-5H2,1H3.
What are the key properties of 5-chloro-2-ethylpentanal?
5-chloro-2-ethylpentanal has a molecular weight of 148.63 g/mol, XLogP of 2.23, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-ethylpentanal is sourced from PubChem (CID 13118181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).