About N-[(5-bromothiophen-3-yl)methyl]-2,2-difluoropropanamide
N-[(5-bromothiophen-3-yl)methyl]-2,2-difluoropropanamide (PubChem CID 131182334) has the molecular formula C8H8BrF2NOS
and a molecular weight of 284.12 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-2,2-difluoropropanamide.
Molecular Properties
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-2,2-difluoropropanamide |
| PubChem CID | 131182334 |
| Molecular Formula | C8H8BrF2NOS |
| Molecular Weight | 284.12 g/mol |
| Exact Mass | 282.95 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-2,2-difluoropropanamide |
| SMILES | CC(F)(F)C(=O)NCc1csc(Br)c1 |
| InChI | InChI=1S/C8H8BrF2NOS/c1-8(10,11)7(13)12-3-5-2-6(9)14-4-5/h2,4H,3H2,1H3,(H,12,13) |
| InChIKey | IKPXYWHSADKABB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.12 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(5-bromothiophen-3-yl)methyl]-2,2-difluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-bromothiophen-3-yl)methyl]-2,2-difluoropropanamide?
The IUPAC name of N-[(5-bromothiophen-3-yl)methyl]-2,2-difluoropropanamide (CID 131182334) is N-[(5-bromothiophen-3-yl)methyl]-2,2-difluoropropanamide.
What is the SMILES notation for N-[(5-bromothiophen-3-yl)methyl]-2,2-difluoropropanamide?
The canonical SMILES for N-[(5-bromothiophen-3-yl)methyl]-2,2-difluoropropanamide is CC(F)(F)C(=O)NCc1csc(Br)c1.
What is the InChIKey of N-[(5-bromothiophen-3-yl)methyl]-2,2-difluoropropanamide?
The InChIKey is IKPXYWHSADKABB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrF2NOS/c1-8(10,11)7(13)12-3-5-2-6(9)14-4-5/h2,4H,3H2,1H3,(H,12,13).
What are the key properties of N-[(5-bromothiophen-3-yl)methyl]-2,2-difluoropropanamide?
N-[(5-bromothiophen-3-yl)methyl]-2,2-difluoropropanamide has a molecular weight of 284.12 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-bromothiophen-3-yl)methyl]-2,2-difluoropropanamide is sourced from PubChem (CID 131182334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).