About N-(1-bromopropan-2-yl)-3,3-difluorocyclobutane-1-carboxamide
N-(1-bromopropan-2-yl)-3,3-difluorocyclobutane-1-carboxamide (PubChem CID 131182397) has the molecular formula C8H12BrF2NO
and a molecular weight of 256.09 g/mol. Its IUPAC name is N-(1-bromopropan-2-yl)-3,3-difluorocyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | N-(1-bromopropan-2-yl)-3,3-difluorocyclobutane-1-carboxamide |
| PubChem CID | 131182397 |
| Molecular Formula | C8H12BrF2NO |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | N-(1-bromopropan-2-yl)-3,3-difluorocyclobutane-1-carboxamide |
| SMILES | CC(CBr)NC(=O)C1CC(F)(F)C1 |
| InChI | InChI=1S/C8H12BrF2NO/c1-5(4-9)12-7(13)6-2-8(10,11)3-6/h5-6H,2-4H2,1H3,(H,12,13) |
| InChIKey | KMPGFKMVYDJJHH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(1-bromopropan-2-yl)-3,3-difluorocyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-bromopropan-2-yl)-3,3-difluorocyclobutane-1-carboxamide?
The IUPAC name of N-(1-bromopropan-2-yl)-3,3-difluorocyclobutane-1-carboxamide (CID 131182397) is N-(1-bromopropan-2-yl)-3,3-difluorocyclobutane-1-carboxamide.
What is the SMILES notation for N-(1-bromopropan-2-yl)-3,3-difluorocyclobutane-1-carboxamide?
The canonical SMILES for N-(1-bromopropan-2-yl)-3,3-difluorocyclobutane-1-carboxamide is CC(CBr)NC(=O)C1CC(F)(F)C1.
What is the InChIKey of N-(1-bromopropan-2-yl)-3,3-difluorocyclobutane-1-carboxamide?
The InChIKey is KMPGFKMVYDJJHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12BrF2NO/c1-5(4-9)12-7(13)6-2-8(10,11)3-6/h5-6H,2-4H2,1H3,(H,12,13).
What are the key properties of N-(1-bromopropan-2-yl)-3,3-difluorocyclobutane-1-carboxamide?
N-(1-bromopropan-2-yl)-3,3-difluorocyclobutane-1-carboxamide has a molecular weight of 256.09 g/mol, XLogP of 1.93, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-bromopropan-2-yl)-3,3-difluorocyclobutane-1-carboxamide is sourced from PubChem (CID 131182397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).