About 2-[[(1R,2R)-2-(hydroxymethyl)cyclopropyl]amino]pyridine-3-carbonitrile
2-[[(1R,2R)-2-(hydroxymethyl)cyclopropyl]amino]pyridine-3-carbonitrile (PubChem CID 131182956) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-(hydroxymethyl)cyclopropyl]amino]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-[[(1R,2R)-2-(hydroxymethyl)cyclopropyl]amino]pyridine-3-carbonitrile |
| PubChem CID | 131182956 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2-[[(1R,2R)-2-(hydroxymethyl)cyclopropyl]amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1N[C@@H]1C[C@H]1CO |
| InChI | InChI=1S/C10H11N3O/c11-5-7-2-1-3-12-10(7)13-9-4-8(9)6-14/h1-3,8-9,14H,4,6H2,(H,12,13)/t8-,9+/m0/s1 |
| InChIKey | HBWBIWKJFVLEKE-DTWKUNHWSA-N |
| XLogP | 0.75 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[(1R,2R)-2-(hydroxymethyl)cyclopropyl]amino]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1R,2R)-2-(hydroxymethyl)cyclopropyl]amino]pyridine-3-carbonitrile?
The IUPAC name of 2-[[(1R,2R)-2-(hydroxymethyl)cyclopropyl]amino]pyridine-3-carbonitrile (CID 131182956) is 2-[[(1R,2R)-2-(hydroxymethyl)cyclopropyl]amino]pyridine-3-carbonitrile.
What is the SMILES notation for 2-[[(1R,2R)-2-(hydroxymethyl)cyclopropyl]amino]pyridine-3-carbonitrile?
The canonical SMILES for 2-[[(1R,2R)-2-(hydroxymethyl)cyclopropyl]amino]pyridine-3-carbonitrile is N#Cc1cccnc1N[C@@H]1C[C@H]1CO.
What is the InChIKey of 2-[[(1R,2R)-2-(hydroxymethyl)cyclopropyl]amino]pyridine-3-carbonitrile?
The InChIKey is HBWBIWKJFVLEKE-DTWKUNHWSA-N. The full InChI is InChI=1S/C10H11N3O/c11-5-7-2-1-3-12-10(7)13-9-4-8(9)6-14/h1-3,8-9,14H,4,6H2,(H,12,13)/t8-,9+/m0/s1.
What are the key properties of 2-[[(1R,2R)-2-(hydroxymethyl)cyclopropyl]amino]pyridine-3-carbonitrile?
2-[[(1R,2R)-2-(hydroxymethyl)cyclopropyl]amino]pyridine-3-carbonitrile has a molecular weight of 189.22 g/mol, XLogP of 0.75, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1R,2R)-2-(hydroxymethyl)cyclopropyl]amino]pyridine-3-carbonitrile is sourced from PubChem (CID 131182956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).