About 3-[2-cyanopropan-2-yl(methyl)amino]-2,2-dimethylpropanenitrile
3-[2-cyanopropan-2-yl(methyl)amino]-2,2-dimethylpropanenitrile (PubChem CID 131182992) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 3-[2-cyanopropan-2-yl(methyl)amino]-2,2-dimethylpropanenitrile.
Molecular Properties
| Compound Name | 3-[2-cyanopropan-2-yl(methyl)amino]-2,2-dimethylpropanenitrile |
| PubChem CID | 131182992 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 3-[2-cyanopropan-2-yl(methyl)amino]-2,2-dimethylpropanenitrile |
| SMILES | CN(CC(C)(C)C#N)C(C)(C)C#N |
| InChI | InChI=1S/C10H17N3/c1-9(2,6-11)8-13(5)10(3,4)7-12/h8H2,1-5H3 |
| InChIKey | ZNDQWYCRJFRFQN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-cyanopropan-2-yl(methyl)amino]-2,2-dimethylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-cyanopropan-2-yl(methyl)amino]-2,2-dimethylpropanenitrile?
The IUPAC name of 3-[2-cyanopropan-2-yl(methyl)amino]-2,2-dimethylpropanenitrile (CID 131182992) is 3-[2-cyanopropan-2-yl(methyl)amino]-2,2-dimethylpropanenitrile.
What is the SMILES notation for 3-[2-cyanopropan-2-yl(methyl)amino]-2,2-dimethylpropanenitrile?
The canonical SMILES for 3-[2-cyanopropan-2-yl(methyl)amino]-2,2-dimethylpropanenitrile is CN(CC(C)(C)C#N)C(C)(C)C#N.
What is the InChIKey of 3-[2-cyanopropan-2-yl(methyl)amino]-2,2-dimethylpropanenitrile?
The InChIKey is ZNDQWYCRJFRFQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-9(2,6-11)8-13(5)10(3,4)7-12/h8H2,1-5H3.
What are the key properties of 3-[2-cyanopropan-2-yl(methyl)amino]-2,2-dimethylpropanenitrile?
3-[2-cyanopropan-2-yl(methyl)amino]-2,2-dimethylpropanenitrile has a molecular weight of 179.27 g/mol, XLogP of 1.77, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-cyanopropan-2-yl(methyl)amino]-2,2-dimethylpropanenitrile is sourced from PubChem (CID 131182992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).