About 4-(2-bromoethyl)-2-propan-2-yl-1,4-oxazepane
4-(2-bromoethyl)-2-propan-2-yl-1,4-oxazepane (PubChem CID 131183019) has the molecular formula C10H20BrNO
and a molecular weight of 250.18 g/mol. Its IUPAC name is 4-(2-bromoethyl)-2-propan-2-yl-1,4-oxazepane.
Molecular Properties
| Compound Name | 4-(2-bromoethyl)-2-propan-2-yl-1,4-oxazepane |
| PubChem CID | 131183019 |
| Molecular Formula | C10H20BrNO |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 4-(2-bromoethyl)-2-propan-2-yl-1,4-oxazepane |
| SMILES | CC(C)C1CN(CCBr)CCCO1 |
| InChI | InChI=1S/C10H20BrNO/c1-9(2)10-8-12(6-4-11)5-3-7-13-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | IHLDTCUGLUOYQM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-bromoethyl)-2-propan-2-yl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromoethyl)-2-propan-2-yl-1,4-oxazepane?
The IUPAC name of 4-(2-bromoethyl)-2-propan-2-yl-1,4-oxazepane (CID 131183019) is 4-(2-bromoethyl)-2-propan-2-yl-1,4-oxazepane.
What is the SMILES notation for 4-(2-bromoethyl)-2-propan-2-yl-1,4-oxazepane?
The canonical SMILES for 4-(2-bromoethyl)-2-propan-2-yl-1,4-oxazepane is CC(C)C1CN(CCBr)CCCO1.
What is the InChIKey of 4-(2-bromoethyl)-2-propan-2-yl-1,4-oxazepane?
The InChIKey is IHLDTCUGLUOYQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20BrNO/c1-9(2)10-8-12(6-4-11)5-3-7-13-10/h9-10H,3-8H2,1-2H3.
What are the key properties of 4-(2-bromoethyl)-2-propan-2-yl-1,4-oxazepane?
4-(2-bromoethyl)-2-propan-2-yl-1,4-oxazepane has a molecular weight of 250.18 g/mol, XLogP of 2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromoethyl)-2-propan-2-yl-1,4-oxazepane is sourced from PubChem (CID 131183019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).