About 4-benzyl-2-propyl-1,2,5-thiadiazol-3-one
4-benzyl-2-propyl-1,2,5-thiadiazol-3-one (PubChem CID 13118310) has the molecular formula C12H14N2OS
and a molecular weight of 234.32 g/mol. Its IUPAC name is 4-benzyl-2-propyl-1,2,5-thiadiazol-3-one.
Molecular Properties
| Compound Name | 4-benzyl-2-propyl-1,2,5-thiadiazol-3-one |
| PubChem CID | 13118310 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 4-benzyl-2-propyl-1,2,5-thiadiazol-3-one |
| SMILES | CCCn1snc(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C12H14N2OS/c1-2-8-14-12(15)11(13-16-14)9-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| InChIKey | AAQAEOBWNYIZMA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-benzyl-2-propyl-1,2,5-thiadiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-2-propyl-1,2,5-thiadiazol-3-one?
The IUPAC name of 4-benzyl-2-propyl-1,2,5-thiadiazol-3-one (CID 13118310) is 4-benzyl-2-propyl-1,2,5-thiadiazol-3-one.
What is the SMILES notation for 4-benzyl-2-propyl-1,2,5-thiadiazol-3-one?
The canonical SMILES for 4-benzyl-2-propyl-1,2,5-thiadiazol-3-one is CCCn1snc(Cc2ccccc2)c1=O.
What is the InChIKey of 4-benzyl-2-propyl-1,2,5-thiadiazol-3-one?
The InChIKey is AAQAEOBWNYIZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2OS/c1-2-8-14-12(15)11(13-16-14)9-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3.
What are the key properties of 4-benzyl-2-propyl-1,2,5-thiadiazol-3-one?
4-benzyl-2-propyl-1,2,5-thiadiazol-3-one has a molecular weight of 234.32 g/mol, XLogP of 2.31, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-2-propyl-1,2,5-thiadiazol-3-one is sourced from PubChem (CID 13118310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).