About 1-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]tetrazol-5-amine
1-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]tetrazol-5-amine (PubChem CID 131185833) has the molecular formula C6H10N8
and a molecular weight of 194.20 g/mol. Its IUPAC name is 1-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]tetrazol-5-amine.
Molecular Properties
| Compound Name | 1-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]tetrazol-5-amine |
| PubChem CID | 131185833 |
| Molecular Formula | C6H10N8 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 1-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]tetrazol-5-amine |
| SMILES | Cc1nncn1CCn1nnnc1N |
| InChI | InChI=1S/C6H10N8/c1-5-9-8-4-13(5)2-3-14-6(7)10-11-12-14/h4H,2-3H2,1H3,(H2,7,10,12) |
| InChIKey | IVYFFVRJJWICTN-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 100.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]tetrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]tetrazol-5-amine?
The IUPAC name of 1-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]tetrazol-5-amine (CID 131185833) is 1-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]tetrazol-5-amine.
What is the SMILES notation for 1-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]tetrazol-5-amine?
The canonical SMILES for 1-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]tetrazol-5-amine is Cc1nncn1CCn1nnnc1N.
What is the InChIKey of 1-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]tetrazol-5-amine?
The InChIKey is IVYFFVRJJWICTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N8/c1-5-9-8-4-13(5)2-3-14-6(7)10-11-12-14/h4H,2-3H2,1H3,(H2,7,10,12).
What are the key properties of 1-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]tetrazol-5-amine?
1-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]tetrazol-5-amine has a molecular weight of 194.20 g/mol, XLogP of -1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3-methyl-1,2,4-triazol-4-yl)ethyl]tetrazol-5-amine is sourced from PubChem (CID 131185833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).