About [2-oxo-2-(2,3,6-trimethyl-N-(2-oxooxolan-3-yl)anilino)ethyl] acetate
[2-oxo-2-(2,3,6-trimethyl-N-(2-oxooxolan-3-yl)anilino)ethyl] acetate (PubChem CID 13118641) has the molecular formula C17H21NO5
and a molecular weight of 319.36 g/mol. Its IUPAC name is [2-oxo-2-(2,3,6-trimethyl-N-(2-oxooxolan-3-yl)anilino)ethyl] acetate.
Molecular Properties
| Compound Name | [2-oxo-2-(2,3,6-trimethyl-N-(2-oxooxolan-3-yl)anilino)ethyl] acetate |
| PubChem CID | 13118641 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | [2-oxo-2-(2,3,6-trimethyl-N-(2-oxooxolan-3-yl)anilino)ethyl] acetate |
| SMILES | CC(=O)OCC(=O)N(c1c(C)ccc(C)c1C)C1CCOC1=O |
| InChI | InChI=1S/C17H21NO5/c1-10-5-6-11(2)16(12(10)3)18(14-7-8-22-17(14)21)15(20)9-23-13(4)19/h5-6,14H,7-9H2,1-4H3 |
| InChIKey | DNBYUQDDOQLZSX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-oxo-2-(2,3,6-trimethyl-N-(2-oxooxolan-3-yl)anilino)ethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2,3,6-trimethyl-N-(2-oxooxolan-3-yl)anilino)ethyl] acetate?
The IUPAC name of [2-oxo-2-(2,3,6-trimethyl-N-(2-oxooxolan-3-yl)anilino)ethyl] acetate (CID 13118641) is [2-oxo-2-(2,3,6-trimethyl-N-(2-oxooxolan-3-yl)anilino)ethyl] acetate.
What is the SMILES notation for [2-oxo-2-(2,3,6-trimethyl-N-(2-oxooxolan-3-yl)anilino)ethyl] acetate?
The canonical SMILES for [2-oxo-2-(2,3,6-trimethyl-N-(2-oxooxolan-3-yl)anilino)ethyl] acetate is CC(=O)OCC(=O)N(c1c(C)ccc(C)c1C)C1CCOC1=O.
What is the InChIKey of [2-oxo-2-(2,3,6-trimethyl-N-(2-oxooxolan-3-yl)anilino)ethyl] acetate?
The InChIKey is DNBYUQDDOQLZSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO5/c1-10-5-6-11(2)16(12(10)3)18(14-7-8-22-17(14)21)15(20)9-23-13(4)19/h5-6,14H,7-9H2,1-4H3.
What are the key properties of [2-oxo-2-(2,3,6-trimethyl-N-(2-oxooxolan-3-yl)anilino)ethyl] acetate?
[2-oxo-2-(2,3,6-trimethyl-N-(2-oxooxolan-3-yl)anilino)ethyl] acetate has a molecular weight of 319.36 g/mol, XLogP of 1.82, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2,3,6-trimethyl-N-(2-oxooxolan-3-yl)anilino)ethyl] acetate is sourced from PubChem (CID 13118641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).