C9H11N5 — CID 131187800
5-(5,6-dimethyl-2-pyridinyl)-1H-1,2,4-triazol-3-amine (PubChem CID 131187800) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is 5-(5,6-dimethyl-2-pyridinyl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(5,6-dimethyl-2-pyridinyl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 131187800 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 5-(5,6-dimethyl-2-pyridinyl)-1H-1,2,4-triazol-3-amine |
| SMILES | Cc1ccc(-c2nc(N)n[nH]2)nc1C |
| InChI | InChI=1S/C9H11N5/c1-5-3-4-7(11-6(5)2)8-12-9(10)14-13-8/h3-4H,1-2H3,(H3,10,12,13,14) |
| InChIKey | XNTWGCLBSPYPGR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |