C22H49OSi2 — CID 13118874
1,1,2,2-Tetrakis(2,2-dimethylpropyl)-1-ethoxydisilane (PubChem CID 13118874) has the molecular formula C22H49OSi2 and a molecular weight of 385.81 g/mol.
| Compound Name | 1,1,2,2-Tetrakis(2,2-dimethylpropyl)-1-ethoxydisilane |
|---|---|
| PubChem CID | 13118874 |
| Molecular Formula | C22H49OSi2 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.33 |
| IUPAC Name | — |
| SMILES | CCO[Si](CC(C)(C)C)(CC(C)(C)C)[Si](CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C22H49OSi2/c1-14-23-25(17-21(8,9)10,18-22(11,12)13)24(15-19(2,3)4)16-20(5,6)7/h14-18H2,1-13H3 |
| InChIKey | IDEXXKRBUXTGJB-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|