C11H14INO — CID 131188755
(1R,2S)-2-amino-1-cyclopropyl-2-(3-iodophenyl)ethanol (PubChem CID 131188755) has the molecular formula C11H14INO and a molecular weight of 303.14 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-cyclopropyl-2-(3-iodophenyl)ethanol.
| Compound Name | (1R,2S)-2-amino-1-cyclopropyl-2-(3-iodophenyl)ethanol |
|---|---|
| PubChem CID | 131188755 |
| Molecular Formula | C11H14INO |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | (1R,2S)-2-amino-1-cyclopropyl-2-(3-iodophenyl)ethanol |
| SMILES | N[C@@H](c1cccc(I)c1)[C@H](O)C1CC1 |
| InChI | InChI=1S/C11H14INO/c12-9-3-1-2-8(6-9)10(13)11(14)7-4-5-7/h1-3,6-7,10-11,14H,4-5,13H2/t10-,11+/m0/s1 |
| InChIKey | RAKUJDYTJRBDKB-WDEREUQCSA-N |
| XLogP | 2.06 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|