About 2-sulfanylidene-3H-1,3-benzoxazole-4-sulfonyl chloride
2-sulfanylidene-3H-1,3-benzoxazole-4-sulfonyl chloride (PubChem CID 131190249) has the molecular formula C7H4ClNO3S2
and a molecular weight of 249.70 g/mol. Its IUPAC name is 2-sulfanylidene-3H-1,3-benzoxazole-4-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-sulfanylidene-3H-1,3-benzoxazole-4-sulfonyl chloride |
| PubChem CID | 131190249 |
| Molecular Formula | C7H4ClNO3S2 |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 248.93 |
| IUPAC Name | 2-sulfanylidene-3H-1,3-benzoxazole-4-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cccc2oc(=S)[nH]c12 |
| InChI | InChI=1S/C7H4ClNO3S2/c8-14(10,11)5-3-1-2-4-6(5)9-7(13)12-4/h1-3H,(H,9,13) |
| InChIKey | POJTVTMIYFUECB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylidene-3H-1,3-benzoxazole-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylidene-3H-1,3-benzoxazole-4-sulfonyl chloride?
The IUPAC name of 2-sulfanylidene-3H-1,3-benzoxazole-4-sulfonyl chloride (CID 131190249) is 2-sulfanylidene-3H-1,3-benzoxazole-4-sulfonyl chloride.
What is the SMILES notation for 2-sulfanylidene-3H-1,3-benzoxazole-4-sulfonyl chloride?
The canonical SMILES for 2-sulfanylidene-3H-1,3-benzoxazole-4-sulfonyl chloride is O=S(=O)(Cl)c1cccc2oc(=S)[nH]c12.
What is the InChIKey of 2-sulfanylidene-3H-1,3-benzoxazole-4-sulfonyl chloride?
The InChIKey is POJTVTMIYFUECB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClNO3S2/c8-14(10,11)5-3-1-2-4-6(5)9-7(13)12-4/h1-3H,(H,9,13).
What are the key properties of 2-sulfanylidene-3H-1,3-benzoxazole-4-sulfonyl chloride?
2-sulfanylidene-3H-1,3-benzoxazole-4-sulfonyl chloride has a molecular weight of 249.70 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylidene-3H-1,3-benzoxazole-4-sulfonyl chloride is sourced from PubChem (CID 131190249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).