C9H14N2OS — CID 131190544
piperidin-3-yl(1,2-thiazol-3-yl)methanol (PubChem CID 131190544) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is piperidin-3-yl(1,2-thiazol-3-yl)methanol.
| Compound Name | piperidin-3-yl(1,2-thiazol-3-yl)methanol |
|---|---|
| PubChem CID | 131190544 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | piperidin-3-yl(1,2-thiazol-3-yl)methanol |
| SMILES | OC(c1ccsn1)C1CCCNC1 |
| InChI | InChI=1S/C9H14N2OS/c12-9(8-3-5-13-11-8)7-2-1-4-10-6-7/h3,5,7,9-10,12H,1-2,4,6H2 |
| InChIKey | VJJOHSISNSGCGG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |