About 1-chloro-1-(3,5-diaminophenyl)propan-2-one
1-chloro-1-(3,5-diaminophenyl)propan-2-one (PubChem CID 131191279) has the molecular formula C9H11ClN2O
and a molecular weight of 198.65 g/mol. Its IUPAC name is 1-chloro-1-(3,5-diaminophenyl)propan-2-one.
Molecular Properties
| Compound Name | 1-chloro-1-(3,5-diaminophenyl)propan-2-one |
| PubChem CID | 131191279 |
| Molecular Formula | C9H11ClN2O |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 1-chloro-1-(3,5-diaminophenyl)propan-2-one |
| SMILES | CC(=O)C(Cl)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C9H11ClN2O/c1-5(13)9(10)6-2-7(11)4-8(12)3-6/h2-4,9H,11-12H2,1H3 |
| InChIKey | CEGWACINUDMVKM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1-(3,5-diaminophenyl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1-(3,5-diaminophenyl)propan-2-one?
The IUPAC name of 1-chloro-1-(3,5-diaminophenyl)propan-2-one (CID 131191279) is 1-chloro-1-(3,5-diaminophenyl)propan-2-one.
What is the SMILES notation for 1-chloro-1-(3,5-diaminophenyl)propan-2-one?
The canonical SMILES for 1-chloro-1-(3,5-diaminophenyl)propan-2-one is CC(=O)C(Cl)c1cc(N)cc(N)c1.
What is the InChIKey of 1-chloro-1-(3,5-diaminophenyl)propan-2-one?
The InChIKey is CEGWACINUDMVKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN2O/c1-5(13)9(10)6-2-7(11)4-8(12)3-6/h2-4,9H,11-12H2,1H3.
What are the key properties of 1-chloro-1-(3,5-diaminophenyl)propan-2-one?
1-chloro-1-(3,5-diaminophenyl)propan-2-one has a molecular weight of 198.65 g/mol, XLogP of 1.72, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1-(3,5-diaminophenyl)propan-2-one is sourced from PubChem (CID 131191279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).