About 5-hydrazinylbenzene-1,3-dicarbaldehyde
5-hydrazinylbenzene-1,3-dicarbaldehyde (PubChem CID 131191320) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is 5-hydrazinylbenzene-1,3-dicarbaldehyde.
Molecular Properties
| Compound Name | 5-hydrazinylbenzene-1,3-dicarbaldehyde |
| PubChem CID | 131191320 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 5-hydrazinylbenzene-1,3-dicarbaldehyde |
| SMILES | NNc1cc(C=O)cc(C=O)c1 |
| InChI | InChI=1S/C8H8N2O2/c9-10-8-2-6(4-11)1-7(3-8)5-12/h1-5,10H,9H2 |
| InChIKey | OUJFNCPTHNJGFU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-hydrazinylbenzene-1,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydrazinylbenzene-1,3-dicarbaldehyde?
The IUPAC name of 5-hydrazinylbenzene-1,3-dicarbaldehyde (CID 131191320) is 5-hydrazinylbenzene-1,3-dicarbaldehyde.
What is the SMILES notation for 5-hydrazinylbenzene-1,3-dicarbaldehyde?
The canonical SMILES for 5-hydrazinylbenzene-1,3-dicarbaldehyde is NNc1cc(C=O)cc(C=O)c1.
What is the InChIKey of 5-hydrazinylbenzene-1,3-dicarbaldehyde?
The InChIKey is OUJFNCPTHNJGFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c9-10-8-2-6(4-11)1-7(3-8)5-12/h1-5,10H,9H2.
What are the key properties of 5-hydrazinylbenzene-1,3-dicarbaldehyde?
5-hydrazinylbenzene-1,3-dicarbaldehyde has a molecular weight of 164.16 g/mol, XLogP of 0.60, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydrazinylbenzene-1,3-dicarbaldehyde is sourced from PubChem (CID 131191320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).