C9H7BrO2S — CID 131191603
5-(bromomethyl)-1-benzothiophene-3,6-diol (PubChem CID 131191603) has the molecular formula C9H7BrO2S and a molecular weight of 259.12 g/mol. Its IUPAC name is 5-(bromomethyl)-1-benzothiophene-3,6-diol.
| Compound Name | 5-(bromomethyl)-1-benzothiophene-3,6-diol |
|---|---|
| PubChem CID | 131191603 |
| Molecular Formula | C9H7BrO2S |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 257.94 |
| IUPAC Name | 5-(bromomethyl)-1-benzothiophene-3,6-diol |
| SMILES | Oc1cc2scc(O)c2cc1CBr |
| InChI | InChI=1S/C9H7BrO2S/c10-3-5-1-6-8(12)4-13-9(6)2-7(5)11/h1-2,4,11-12H,3H2 |
| InChIKey | TXIZSGTXGHSDJH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|