About 1-phenylacenaphthylene
1-phenylacenaphthylene (PubChem CID 13119282) has the molecular formula C18H12
and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-phenylacenaphthylene.
Molecular Properties
| Compound Name | 1-phenylacenaphthylene |
| PubChem CID | 13119282 |
| Molecular Formula | C18H12 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 1-phenylacenaphthylene |
| SMILES | C1=C(c2ccccc2)c2cccc3cccc1c23 |
| InChI | InChI=1S/C18H12/c1-2-6-13(7-3-1)17-12-15-10-4-8-14-9-5-11-16(17)18(14)15/h1-12H |
| InChIKey | RGYRCSKRQNNKOE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylacenaphthylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylacenaphthylene?
The IUPAC name of 1-phenylacenaphthylene (CID 13119282) is 1-phenylacenaphthylene.
What is the SMILES notation for 1-phenylacenaphthylene?
The canonical SMILES for 1-phenylacenaphthylene is C1=C(c2ccccc2)c2cccc3cccc1c23.
What is the InChIKey of 1-phenylacenaphthylene?
The InChIKey is RGYRCSKRQNNKOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12/c1-2-6-13(7-3-1)17-12-15-10-4-8-14-9-5-11-16(17)18(14)15/h1-12H.
What are the key properties of 1-phenylacenaphthylene?
1-phenylacenaphthylene has a molecular weight of 228.29 g/mol, XLogP of 4.74, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylacenaphthylene is sourced from PubChem (CID 13119282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).