About 7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine
7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 131193413) has the molecular formula C8H14FNO2
and a molecular weight of 175.20 g/mol. Its IUPAC name is 7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine.
Molecular Properties
| Compound Name | 7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine |
| PubChem CID | 131193413 |
| Molecular Formula | C8H14FNO2 |
| Molecular Weight | 175.20 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | NC1CCC2(CC1F)OCCO2 |
| InChI | InChI=1S/C8H14FNO2/c9-6-5-8(2-1-7(6)10)11-3-4-12-8/h6-7H,1-5,10H2 |
| InChIKey | NQQAQTHJGLCCRJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.20 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine?
The IUPAC name of 7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine (CID 131193413) is 7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine.
What is the SMILES notation for 7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine?
The canonical SMILES for 7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine is NC1CCC2(CC1F)OCCO2.
What is the InChIKey of 7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine?
The InChIKey is NQQAQTHJGLCCRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14FNO2/c9-6-5-8(2-1-7(6)10)11-3-4-12-8/h6-7H,1-5,10H2.
What are the key properties of 7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine?
7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine has a molecular weight of 175.20 g/mol, XLogP of 0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1,4-dioxaspiro[4.5]decan-8-amine is sourced from PubChem (CID 131193413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).