About [6-(1,2,4-thiadiazol-5-ylsulfanyl)pyridazin-3-yl]methanamine
[6-(1,2,4-thiadiazol-5-ylsulfanyl)pyridazin-3-yl]methanamine (PubChem CID 131195900) has the molecular formula C7H7N5S2
and a molecular weight of 225.30 g/mol. Its IUPAC name is [6-(1,2,4-thiadiazol-5-ylsulfanyl)pyridazin-3-yl]methanamine.
Molecular Properties
| Compound Name | [6-(1,2,4-thiadiazol-5-ylsulfanyl)pyridazin-3-yl]methanamine |
| PubChem CID | 131195900 |
| Molecular Formula | C7H7N5S2 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | [6-(1,2,4-thiadiazol-5-ylsulfanyl)pyridazin-3-yl]methanamine |
| SMILES | NCc1ccc(Sc2ncns2)nn1 |
| InChI | InChI=1S/C7H7N5S2/c8-3-5-1-2-6(12-11-5)13-7-9-4-10-14-7/h1-2,4H,3,8H2 |
| InChIKey | PHAKGRBUZFGZQC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [6-(1,2,4-thiadiazol-5-ylsulfanyl)pyridazin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(1,2,4-thiadiazol-5-ylsulfanyl)pyridazin-3-yl]methanamine?
The IUPAC name of [6-(1,2,4-thiadiazol-5-ylsulfanyl)pyridazin-3-yl]methanamine (CID 131195900) is [6-(1,2,4-thiadiazol-5-ylsulfanyl)pyridazin-3-yl]methanamine.
What is the SMILES notation for [6-(1,2,4-thiadiazol-5-ylsulfanyl)pyridazin-3-yl]methanamine?
The canonical SMILES for [6-(1,2,4-thiadiazol-5-ylsulfanyl)pyridazin-3-yl]methanamine is NCc1ccc(Sc2ncns2)nn1.
What is the InChIKey of [6-(1,2,4-thiadiazol-5-ylsulfanyl)pyridazin-3-yl]methanamine?
The InChIKey is PHAKGRBUZFGZQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5S2/c8-3-5-1-2-6(12-11-5)13-7-9-4-10-14-7/h1-2,4H,3,8H2.
What are the key properties of [6-(1,2,4-thiadiazol-5-ylsulfanyl)pyridazin-3-yl]methanamine?
[6-(1,2,4-thiadiazol-5-ylsulfanyl)pyridazin-3-yl]methanamine has a molecular weight of 225.30 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(1,2,4-thiadiazol-5-ylsulfanyl)pyridazin-3-yl]methanamine is sourced from PubChem (CID 131195900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).