C10H15F2NO — CID 131196465
(3,3-difluorocyclobutyl)-piperidin-1-ylmethanone (PubChem CID 131196465) has the molecular formula C10H15F2NO and a molecular weight of 203.23 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)-piperidin-1-ylmethanone.
| Compound Name | (3,3-difluorocyclobutyl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 131196465 |
| Molecular Formula | C10H15F2NO |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | (3,3-difluorocyclobutyl)-piperidin-1-ylmethanone |
| SMILES | O=C(C1CC(F)(F)C1)N1CCCCC1 |
| InChI | InChI=1S/C10H15F2NO/c11-10(12)6-8(7-10)9(14)13-4-2-1-3-5-13/h8H,1-7H2 |
| InChIKey | LFMMOQHJIBOJQJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |