About 2-fluoro-N-(1,3-oxazol-4-ylmethyl)pyridin-4-amine
2-fluoro-N-(1,3-oxazol-4-ylmethyl)pyridin-4-amine (PubChem CID 131198015) has the molecular formula C9H8FN3O
and a molecular weight of 193.18 g/mol. Its IUPAC name is 2-fluoro-N-(1,3-oxazol-4-ylmethyl)pyridin-4-amine.
Molecular Properties
| Compound Name | 2-fluoro-N-(1,3-oxazol-4-ylmethyl)pyridin-4-amine |
| PubChem CID | 131198015 |
| Molecular Formula | C9H8FN3O |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-fluoro-N-(1,3-oxazol-4-ylmethyl)pyridin-4-amine |
| SMILES | Fc1cc(NCc2cocn2)ccn1 |
| InChI | InChI=1S/C9H8FN3O/c10-9-3-7(1-2-11-9)12-4-8-5-14-6-13-8/h1-3,5-6H,4H2,(H,11,12) |
| InChIKey | ISYUTJSCXPCDAW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N-(1,3-oxazol-4-ylmethyl)pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-(1,3-oxazol-4-ylmethyl)pyridin-4-amine?
The IUPAC name of 2-fluoro-N-(1,3-oxazol-4-ylmethyl)pyridin-4-amine (CID 131198015) is 2-fluoro-N-(1,3-oxazol-4-ylmethyl)pyridin-4-amine.
What is the SMILES notation for 2-fluoro-N-(1,3-oxazol-4-ylmethyl)pyridin-4-amine?
The canonical SMILES for 2-fluoro-N-(1,3-oxazol-4-ylmethyl)pyridin-4-amine is Fc1cc(NCc2cocn2)ccn1.
What is the InChIKey of 2-fluoro-N-(1,3-oxazol-4-ylmethyl)pyridin-4-amine?
The InChIKey is ISYUTJSCXPCDAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FN3O/c10-9-3-7(1-2-11-9)12-4-8-5-14-6-13-8/h1-3,5-6H,4H2,(H,11,12).
What are the key properties of 2-fluoro-N-(1,3-oxazol-4-ylmethyl)pyridin-4-amine?
2-fluoro-N-(1,3-oxazol-4-ylmethyl)pyridin-4-amine has a molecular weight of 193.18 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-(1,3-oxazol-4-ylmethyl)pyridin-4-amine is sourced from PubChem (CID 131198015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).