About 5-(2-fluoro-1-methylcyclopropyl)-3-iodo-1,2,4-thiadiazole
5-(2-fluoro-1-methylcyclopropyl)-3-iodo-1,2,4-thiadiazole (PubChem CID 131198196) has the molecular formula C6H6FIN2S
and a molecular weight of 284.10 g/mol. Its IUPAC name is 5-(2-fluoro-1-methylcyclopropyl)-3-iodo-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 5-(2-fluoro-1-methylcyclopropyl)-3-iodo-1,2,4-thiadiazole |
| PubChem CID | 131198196 |
| Molecular Formula | C6H6FIN2S |
| Molecular Weight | 284.10 g/mol |
| Exact Mass | 283.93 |
| IUPAC Name | 5-(2-fluoro-1-methylcyclopropyl)-3-iodo-1,2,4-thiadiazole |
| SMILES | CC1(c2nc(I)ns2)CC1F |
| InChI | InChI=1S/C6H6FIN2S/c1-6(2-3(6)7)4-9-5(8)10-11-4/h3H,2H2,1H3 |
| InChIKey | VEJRKVZOGPHEFC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.10 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-fluoro-1-methylcyclopropyl)-3-iodo-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluoro-1-methylcyclopropyl)-3-iodo-1,2,4-thiadiazole?
The IUPAC name of 5-(2-fluoro-1-methylcyclopropyl)-3-iodo-1,2,4-thiadiazole (CID 131198196) is 5-(2-fluoro-1-methylcyclopropyl)-3-iodo-1,2,4-thiadiazole.
What is the SMILES notation for 5-(2-fluoro-1-methylcyclopropyl)-3-iodo-1,2,4-thiadiazole?
The canonical SMILES for 5-(2-fluoro-1-methylcyclopropyl)-3-iodo-1,2,4-thiadiazole is CC1(c2nc(I)ns2)CC1F.
What is the InChIKey of 5-(2-fluoro-1-methylcyclopropyl)-3-iodo-1,2,4-thiadiazole?
The InChIKey is VEJRKVZOGPHEFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FIN2S/c1-6(2-3(6)7)4-9-5(8)10-11-4/h3H,2H2,1H3.
What are the key properties of 5-(2-fluoro-1-methylcyclopropyl)-3-iodo-1,2,4-thiadiazole?
5-(2-fluoro-1-methylcyclopropyl)-3-iodo-1,2,4-thiadiazole has a molecular weight of 284.10 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluoro-1-methylcyclopropyl)-3-iodo-1,2,4-thiadiazole is sourced from PubChem (CID 131198196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).