About 1-(4-acetylphenyl)-2,2,2-trifluoroethanone
1-(4-acetylphenyl)-2,2,2-trifluoroethanone (PubChem CID 13119840) has the molecular formula C10H7F3O2
and a molecular weight of 216.16 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-2,2,2-trifluoroethanone.
Molecular Properties
| Compound Name | 1-(4-acetylphenyl)-2,2,2-trifluoroethanone |
| PubChem CID | 13119840 |
| Molecular Formula | C10H7F3O2 |
| Molecular Weight | 216.16 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 1-(4-acetylphenyl)-2,2,2-trifluoroethanone |
| SMILES | CC(=O)c1ccc(C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H7F3O2/c1-6(14)7-2-4-8(5-3-7)9(15)10(11,12)13/h2-5H,1H3 |
| InChIKey | FCHCYEDIAATYDX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.16 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-acetylphenyl)-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-acetylphenyl)-2,2,2-trifluoroethanone?
The IUPAC name of 1-(4-acetylphenyl)-2,2,2-trifluoroethanone (CID 13119840) is 1-(4-acetylphenyl)-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-(4-acetylphenyl)-2,2,2-trifluoroethanone?
The canonical SMILES for 1-(4-acetylphenyl)-2,2,2-trifluoroethanone is CC(=O)c1ccc(C(=O)C(F)(F)F)cc1.
What is the InChIKey of 1-(4-acetylphenyl)-2,2,2-trifluoroethanone?
The InChIKey is FCHCYEDIAATYDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F3O2/c1-6(14)7-2-4-8(5-3-7)9(15)10(11,12)13/h2-5H,1H3.
What are the key properties of 1-(4-acetylphenyl)-2,2,2-trifluoroethanone?
1-(4-acetylphenyl)-2,2,2-trifluoroethanone has a molecular weight of 216.16 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-acetylphenyl)-2,2,2-trifluoroethanone is sourced from PubChem (CID 13119840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).