C9H8O5S2 — CID 13120069
dimethyl 2-(2-oxoethylidene)-1,3-dithiole-4,5-dicarboxylate (PubChem CID 13120069) has the molecular formula C9H8O5S2 and a molecular weight of 260.29 g/mol. Its IUPAC name is dimethyl 2-(2-oxoethylidene)-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-(2-oxoethylidene)-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 13120069 |
| Molecular Formula | C9H8O5S2 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | dimethyl 2-(2-oxoethylidene)-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=CC=O)S1 |
| InChI | InChI=1S/C9H8O5S2/c1-13-8(11)6-7(9(12)14-2)16-5(15-6)3-4-10/h3-4H,1-2H3 |
| InChIKey | YUNBHDKMSIZOBG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|