C16H14O8S4 — CID 13120072
dimethyl 2-[2-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]ethylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 13120072) has the molecular formula C16H14O8S4 and a molecular weight of 462.55 g/mol. Its IUPAC name is dimethyl 2-[2-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]ethylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[2-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]ethylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 13120072 |
| Molecular Formula | C16H14O8S4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 461.96 |
| IUPAC Name | dimethyl 2-[2-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]ethylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=CC=C2SC(C(=O)OC)=C(C(=O)OC)S2)S1 |
| InChI | InChI=1S/C16H14O8S4/c1-21-13(17)9-10(14(18)22-2)26-7(25-9)5-6-8-27-11(15(19)23-3)12(28-8)16(20)24-4/h5-6H,1-4H3 |
| InChIKey | KFRBGKGGJDDNKT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_one_one_A(1)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|