About 1-(2,2-difluoroethyl)-3-ethoxyurea
1-(2,2-difluoroethyl)-3-ethoxyurea (PubChem CID 131200724) has the molecular formula C5H10F2N2O2
and a molecular weight of 168.14 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-ethoxyurea.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethyl)-3-ethoxyurea |
| PubChem CID | 131200724 |
| Molecular Formula | C5H10F2N2O2 |
| Molecular Weight | 168.14 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-ethoxyurea |
| SMILES | CCONC(=O)NCC(F)F |
| InChI | InChI=1S/C5H10F2N2O2/c1-2-11-9-5(10)8-3-4(6)7/h4H,2-3H2,1H3,(H2,8,9,10) |
| InChIKey | JBGUTZXINDQSME-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.14 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-difluoroethyl)-3-ethoxyurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)-3-ethoxyurea?
The IUPAC name of 1-(2,2-difluoroethyl)-3-ethoxyurea (CID 131200724) is 1-(2,2-difluoroethyl)-3-ethoxyurea.
What is the SMILES notation for 1-(2,2-difluoroethyl)-3-ethoxyurea?
The canonical SMILES for 1-(2,2-difluoroethyl)-3-ethoxyurea is CCONC(=O)NCC(F)F.
What is the InChIKey of 1-(2,2-difluoroethyl)-3-ethoxyurea?
The InChIKey is JBGUTZXINDQSME-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10F2N2O2/c1-2-11-9-5(10)8-3-4(6)7/h4H,2-3H2,1H3,(H2,8,9,10).
What are the key properties of 1-(2,2-difluoroethyl)-3-ethoxyurea?
1-(2,2-difluoroethyl)-3-ethoxyurea has a molecular weight of 168.14 g/mol, XLogP of 0.50, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)-3-ethoxyurea is sourced from PubChem (CID 131200724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).