About 1-[(1-fluorocyclopropyl)methyl]-4-methyl-1,4-diazepane
1-[(1-fluorocyclopropyl)methyl]-4-methyl-1,4-diazepane (PubChem CID 131201174) has the molecular formula C10H19FN2
and a molecular weight of 186.27 g/mol. Its IUPAC name is 1-[(1-fluorocyclopropyl)methyl]-4-methyl-1,4-diazepane.
Analyze 1-[(1-fluorocyclopropyl)methyl]-4-methyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-fluorocyclopropyl)methyl]-4-methyl-1,4-diazepane?
The IUPAC name of 1-[(1-fluorocyclopropyl)methyl]-4-methyl-1,4-diazepane (CID 131201174) is 1-[(1-fluorocyclopropyl)methyl]-4-methyl-1,4-diazepane.
What is the SMILES notation for 1-[(1-fluorocyclopropyl)methyl]-4-methyl-1,4-diazepane?
The canonical SMILES for 1-[(1-fluorocyclopropyl)methyl]-4-methyl-1,4-diazepane is CN1CCCN(CC2(F)CC2)CC1.
What is the InChIKey of 1-[(1-fluorocyclopropyl)methyl]-4-methyl-1,4-diazepane?
The InChIKey is OSGANGDTFHQJPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19FN2/c1-12-5-2-6-13(8-7-12)9-10(11)3-4-10/h2-9H2,1H3.
What are the key properties of 1-[(1-fluorocyclopropyl)methyl]-4-methyl-1,4-diazepane?
1-[(1-fluorocyclopropyl)methyl]-4-methyl-1,4-diazepane has a molecular weight of 186.27 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-fluorocyclopropyl)methyl]-4-methyl-1,4-diazepane is sourced from PubChem (CID 131201174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).