C9H14N2O2 — CID 131201326
2-cyclobutyl-5-[(1S)-1-methoxyethyl]-1,3,4-oxadiazole (PubChem CID 131201326) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-cyclobutyl-5-[(1S)-1-methoxyethyl]-1,3,4-oxadiazole.
| Compound Name | 2-cyclobutyl-5-[(1S)-1-methoxyethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 131201326 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2-cyclobutyl-5-[(1S)-1-methoxyethyl]-1,3,4-oxadiazole |
| SMILES | CO[C@@H](C)c1nnc(C2CCC2)o1 |
| InChI | InChI=1S/C9H14N2O2/c1-6(12-2)8-10-11-9(13-8)7-4-3-5-7/h6-7H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | HPJNHPNJIGJHLE-LURJTMIESA-N |
| XLogP | 2.04 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |