C7H9NO2S — CID 131201632
(5-methyl-1,2-thiazol-3-yl)methyl acetate (PubChem CID 131201632) has the molecular formula C7H9NO2S and a molecular weight of 171.22 g/mol. Its IUPAC name is (5-methyl-1,2-thiazol-3-yl)methyl acetate.
| Compound Name | (5-methyl-1,2-thiazol-3-yl)methyl acetate |
|---|---|
| PubChem CID | 131201632 |
| Molecular Formula | C7H9NO2S |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | (5-methyl-1,2-thiazol-3-yl)methyl acetate |
| SMILES | CC(=O)OCc1cc(C)sn1 |
| InChI | InChI=1S/C7H9NO2S/c1-5-3-7(8-11-5)4-10-6(2)9/h3H,4H2,1-2H3 |
| InChIKey | HHZKVLDZJUFPNX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |