About 2-(3,5-dimethyl-1,2-oxazol-4-yl)imidazolidin-4-one
2-(3,5-dimethyl-1,2-oxazol-4-yl)imidazolidin-4-one (PubChem CID 131203449) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)imidazolidin-4-one.
Molecular Properties
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)imidazolidin-4-one |
| PubChem CID | 131203449 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)imidazolidin-4-one |
| SMILES | Cc1noc(C)c1C1NCC(=O)N1 |
| InChI | InChI=1S/C8H11N3O2/c1-4-7(5(2)13-11-4)8-9-3-6(12)10-8/h8-9H,3H2,1-2H3,(H,10,12) |
| InChIKey | IBHOIYBZIDXQHQ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,5-dimethyl-1,2-oxazol-4-yl)imidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethyl-1,2-oxazol-4-yl)imidazolidin-4-one?
The IUPAC name of 2-(3,5-dimethyl-1,2-oxazol-4-yl)imidazolidin-4-one (CID 131203449) is 2-(3,5-dimethyl-1,2-oxazol-4-yl)imidazolidin-4-one.
What is the SMILES notation for 2-(3,5-dimethyl-1,2-oxazol-4-yl)imidazolidin-4-one?
The canonical SMILES for 2-(3,5-dimethyl-1,2-oxazol-4-yl)imidazolidin-4-one is Cc1noc(C)c1C1NCC(=O)N1.
What is the InChIKey of 2-(3,5-dimethyl-1,2-oxazol-4-yl)imidazolidin-4-one?
The InChIKey is IBHOIYBZIDXQHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-4-7(5(2)13-11-4)8-9-3-6(12)10-8/h8-9H,3H2,1-2H3,(H,10,12).
What are the key properties of 2-(3,5-dimethyl-1,2-oxazol-4-yl)imidazolidin-4-one?
2-(3,5-dimethyl-1,2-oxazol-4-yl)imidazolidin-4-one has a molecular weight of 181.19 g/mol, XLogP of 0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-1,2-oxazol-4-yl)imidazolidin-4-one is sourced from PubChem (CID 131203449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).