C9H10O3 — CID 131203971
(4S,4aR)-4-hydroxy-3,4,4a,5-tetrahydroisochromen-6-one (PubChem CID 131203971) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is (4S,4aR)-4-hydroxy-3,4,4a,5-tetrahydroisochromen-6-one.
| Compound Name | (4S,4aR)-4-hydroxy-3,4,4a,5-tetrahydroisochromen-6-one |
|---|---|
| PubChem CID | 131203971 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | (4S,4aR)-4-hydroxy-3,4,4a,5-tetrahydroisochromen-6-one |
| SMILES | O=C1C=CC2=COC[C@@H](O)[C@@H]2C1 |
| InChI | InChI=1S/C9H10O3/c10-7-2-1-6-4-12-5-9(11)8(6)3-7/h1-2,4,8-9,11H,3,5H2/t8-,9-/m1/s1 |
| InChIKey | ZKQSIIODRNFOSY-RKDXNWHRSA-N |
| XLogP | 0.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |