About 2-(3,4-dihydro-2H-pyran-6-yl)-4,4-dimethylpentan-2-ol
2-(3,4-dihydro-2H-pyran-6-yl)-4,4-dimethylpentan-2-ol (PubChem CID 131204250) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-pyran-6-yl)-4,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | 2-(3,4-dihydro-2H-pyran-6-yl)-4,4-dimethylpentan-2-ol |
| PubChem CID | 131204250 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2-(3,4-dihydro-2H-pyran-6-yl)-4,4-dimethylpentan-2-ol |
| SMILES | CC(C)(C)CC(C)(O)C1=CCCCO1 |
| InChI | InChI=1S/C12H22O2/c1-11(2,3)9-12(4,13)10-7-5-6-8-14-10/h7,13H,5-6,8-9H2,1-4H3 |
| InChIKey | FRSDGFNSHGOJIL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,4-dihydro-2H-pyran-6-yl)-4,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydro-2H-pyran-6-yl)-4,4-dimethylpentan-2-ol?
The IUPAC name of 2-(3,4-dihydro-2H-pyran-6-yl)-4,4-dimethylpentan-2-ol (CID 131204250) is 2-(3,4-dihydro-2H-pyran-6-yl)-4,4-dimethylpentan-2-ol.
What is the SMILES notation for 2-(3,4-dihydro-2H-pyran-6-yl)-4,4-dimethylpentan-2-ol?
The canonical SMILES for 2-(3,4-dihydro-2H-pyran-6-yl)-4,4-dimethylpentan-2-ol is CC(C)(C)CC(C)(O)C1=CCCCO1.
What is the InChIKey of 2-(3,4-dihydro-2H-pyran-6-yl)-4,4-dimethylpentan-2-ol?
The InChIKey is FRSDGFNSHGOJIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-11(2,3)9-12(4,13)10-7-5-6-8-14-10/h7,13H,5-6,8-9H2,1-4H3.
What are the key properties of 2-(3,4-dihydro-2H-pyran-6-yl)-4,4-dimethylpentan-2-ol?
2-(3,4-dihydro-2H-pyran-6-yl)-4,4-dimethylpentan-2-ol has a molecular weight of 198.31 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-2H-pyran-6-yl)-4,4-dimethylpentan-2-ol is sourced from PubChem (CID 131204250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).