About 6-chloro-N-(2,2-dimethylbut-3-enyl)pyrimidin-4-amine
6-chloro-N-(2,2-dimethylbut-3-enyl)pyrimidin-4-amine (PubChem CID 131204276) has the molecular formula C10H14ClN3
and a molecular weight of 211.70 g/mol. Its IUPAC name is 6-chloro-N-(2,2-dimethylbut-3-enyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-chloro-N-(2,2-dimethylbut-3-enyl)pyrimidin-4-amine |
| PubChem CID | 131204276 |
| Molecular Formula | C10H14ClN3 |
| Molecular Weight | 211.70 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 6-chloro-N-(2,2-dimethylbut-3-enyl)pyrimidin-4-amine |
| SMILES | C=CC(C)(C)CNc1cc(Cl)ncn1 |
| InChI | InChI=1S/C10H14ClN3/c1-4-10(2,3)6-12-9-5-8(11)13-7-14-9/h4-5,7H,1,6H2,2-3H3,(H,12,13,14) |
| InChIKey | FKQVCKBEULHGQX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.70 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-(2,2-dimethylbut-3-enyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(2,2-dimethylbut-3-enyl)pyrimidin-4-amine?
The IUPAC name of 6-chloro-N-(2,2-dimethylbut-3-enyl)pyrimidin-4-amine (CID 131204276) is 6-chloro-N-(2,2-dimethylbut-3-enyl)pyrimidin-4-amine.
What is the SMILES notation for 6-chloro-N-(2,2-dimethylbut-3-enyl)pyrimidin-4-amine?
The canonical SMILES for 6-chloro-N-(2,2-dimethylbut-3-enyl)pyrimidin-4-amine is C=CC(C)(C)CNc1cc(Cl)ncn1.
What is the InChIKey of 6-chloro-N-(2,2-dimethylbut-3-enyl)pyrimidin-4-amine?
The InChIKey is FKQVCKBEULHGQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN3/c1-4-10(2,3)6-12-9-5-8(11)13-7-14-9/h4-5,7H,1,6H2,2-3H3,(H,12,13,14).
What are the key properties of 6-chloro-N-(2,2-dimethylbut-3-enyl)pyrimidin-4-amine?
6-chloro-N-(2,2-dimethylbut-3-enyl)pyrimidin-4-amine has a molecular weight of 211.70 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(2,2-dimethylbut-3-enyl)pyrimidin-4-amine is sourced from PubChem (CID 131204276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).