About 2-cyclopropyl-N-(2,2-difluoroethyl)acetamide
2-cyclopropyl-N-(2,2-difluoroethyl)acetamide (PubChem CID 131204641) has the molecular formula C7H11F2NO
and a molecular weight of 163.17 g/mol. Its IUPAC name is 2-cyclopropyl-N-(2,2-difluoroethyl)acetamide.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-(2,2-difluoroethyl)acetamide |
| PubChem CID | 131204641 |
| Molecular Formula | C7H11F2NO |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 2-cyclopropyl-N-(2,2-difluoroethyl)acetamide |
| SMILES | O=C(CC1CC1)NCC(F)F |
| InChI | InChI=1S/C7H11F2NO/c8-6(9)4-10-7(11)3-5-1-2-5/h5-6H,1-4H2,(H,10,11) |
| InChIKey | QAQSSAYTKFDUHO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopropyl-N-(2,2-difluoroethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-(2,2-difluoroethyl)acetamide?
The IUPAC name of 2-cyclopropyl-N-(2,2-difluoroethyl)acetamide (CID 131204641) is 2-cyclopropyl-N-(2,2-difluoroethyl)acetamide.
What is the SMILES notation for 2-cyclopropyl-N-(2,2-difluoroethyl)acetamide?
The canonical SMILES for 2-cyclopropyl-N-(2,2-difluoroethyl)acetamide is O=C(CC1CC1)NCC(F)F.
What is the InChIKey of 2-cyclopropyl-N-(2,2-difluoroethyl)acetamide?
The InChIKey is QAQSSAYTKFDUHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2NO/c8-6(9)4-10-7(11)3-5-1-2-5/h5-6H,1-4H2,(H,10,11).
What are the key properties of 2-cyclopropyl-N-(2,2-difluoroethyl)acetamide?
2-cyclopropyl-N-(2,2-difluoroethyl)acetamide has a molecular weight of 163.17 g/mol, XLogP of 1.17, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-(2,2-difluoroethyl)acetamide is sourced from PubChem (CID 131204641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).