About 2-[[(1R,2R)-2-ethylcyclopropyl]amino]propanamide
2-[[(1R,2R)-2-ethylcyclopropyl]amino]propanamide (PubChem CID 131206831) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-ethylcyclopropyl]amino]propanamide.
Molecular Properties
| Compound Name | 2-[[(1R,2R)-2-ethylcyclopropyl]amino]propanamide |
| PubChem CID | 131206831 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 2-[[(1R,2R)-2-ethylcyclopropyl]amino]propanamide |
| SMILES | CC[C@@H]1C[C@H]1NC(C)C(N)=O |
| InChI | InChI=1S/C8H16N2O/c1-3-6-4-7(6)10-5(2)8(9)11/h5-7,10H,3-4H2,1-2H3,(H2,9,11)/t5?,6-,7-/m1/s1 |
| InChIKey | AUDIWEUGANSFCH-JXBXZBNISA-N |
| XLogP | 0.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[(1R,2R)-2-ethylcyclopropyl]amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1R,2R)-2-ethylcyclopropyl]amino]propanamide?
The IUPAC name of 2-[[(1R,2R)-2-ethylcyclopropyl]amino]propanamide (CID 131206831) is 2-[[(1R,2R)-2-ethylcyclopropyl]amino]propanamide.
What is the SMILES notation for 2-[[(1R,2R)-2-ethylcyclopropyl]amino]propanamide?
The canonical SMILES for 2-[[(1R,2R)-2-ethylcyclopropyl]amino]propanamide is CC[C@@H]1C[C@H]1NC(C)C(N)=O.
What is the InChIKey of 2-[[(1R,2R)-2-ethylcyclopropyl]amino]propanamide?
The InChIKey is AUDIWEUGANSFCH-JXBXZBNISA-N. The full InChI is InChI=1S/C8H16N2O/c1-3-6-4-7(6)10-5(2)8(9)11/h5-7,10H,3-4H2,1-2H3,(H2,9,11)/t5?,6-,7-/m1/s1.
What are the key properties of 2-[[(1R,2R)-2-ethylcyclopropyl]amino]propanamide?
2-[[(1R,2R)-2-ethylcyclopropyl]amino]propanamide has a molecular weight of 156.23 g/mol, XLogP of 0.25, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1R,2R)-2-ethylcyclopropyl]amino]propanamide is sourced from PubChem (CID 131206831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).