C12H19NO2 — CID 131207518
3-[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-methylpropanoic acid (PubChem CID 131207518) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-methylpropanoic acid.
| Compound Name | 3-[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 131207518 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3-[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-methylpropanoic acid |
| SMILES | CC(CN1C[C@H]2CC=CC[C@H]2C1)C(=O)O |
| InChI | InChI=1S/C12H19NO2/c1-9(12(14)15)6-13-7-10-4-2-3-5-11(10)8-13/h2-3,9-11H,4-8H2,1H3,(H,14,15)/t9?,10-,11+ |
| InChIKey | HNVFKYJGWRKNQJ-FGWVZKOKSA-N |
| XLogP | 1.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|