C8H16N2O3 — CID 131209286
2-[[(3R,4S)-4-hydroxyoxolan-3-yl]amino]-N-methylpropanamide (PubChem CID 131209286) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-[[(3R,4S)-4-hydroxyoxolan-3-yl]amino]-N-methylpropanamide.
| Compound Name | 2-[[(3R,4S)-4-hydroxyoxolan-3-yl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 131209286 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2-[[(3R,4S)-4-hydroxyoxolan-3-yl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)N[C@@H]1COC[C@H]1O |
| InChI | InChI=1S/C8H16N2O3/c1-5(8(12)9-2)10-6-3-13-4-7(6)11/h5-7,10-11H,3-4H2,1-2H3,(H,9,12)/t5?,6-,7-/m1/s1 |
| InChIKey | WICOFYGDIDPQSN-JXBXZBNISA-N |
| XLogP | -1.53 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |