C23H21N3O2 — CID 13121125
4,5-bis(4-methoxyphenyl)-3,6,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene (PubChem CID 13121125) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 4,5-bis(4-methoxyphenyl)-3,6,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene.
| Compound Name | 4,5-bis(4-methoxyphenyl)-3,6,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
|---|---|
| PubChem CID | 13121125 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 4,5-bis(4-methoxyphenyl)-3,6,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraene |
| SMILES | COc1ccc(-c2nc3n(c2-c2ccc(OC)cc2)CCn2cccc2-3)cc1 |
| InChI | InChI=1S/C23H21N3O2/c1-27-18-9-5-16(6-10-18)21-22(17-7-11-19(28-2)12-8-17)26-15-14-25-13-3-4-20(25)23(26)24-21/h3-13H,14-15H2,1-2H3 |
| InChIKey | DIVLTIWLVJOYQA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |