About thiadiazol-4-ylmethyl propanoate
thiadiazol-4-ylmethyl propanoate (PubChem CID 131211856) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is thiadiazol-4-ylmethyl propanoate.
Molecular Properties
| Compound Name | thiadiazol-4-ylmethyl propanoate |
| PubChem CID | 131211856 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | thiadiazol-4-ylmethyl propanoate |
| SMILES | CCC(=O)OCc1csnn1 |
| InChI | InChI=1S/C6H8N2O2S/c1-2-6(9)10-3-5-4-11-8-7-5/h4H,2-3H2,1H3 |
| InChIKey | IFTDEPMGVNVTKB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze thiadiazol-4-ylmethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiadiazol-4-ylmethyl propanoate?
The IUPAC name of thiadiazol-4-ylmethyl propanoate (CID 131211856) is thiadiazol-4-ylmethyl propanoate.
What is the SMILES notation for thiadiazol-4-ylmethyl propanoate?
The canonical SMILES for thiadiazol-4-ylmethyl propanoate is CCC(=O)OCc1csnn1.
What is the InChIKey of thiadiazol-4-ylmethyl propanoate?
The InChIKey is IFTDEPMGVNVTKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-2-6(9)10-3-5-4-11-8-7-5/h4H,2-3H2,1H3.
What are the key properties of thiadiazol-4-ylmethyl propanoate?
thiadiazol-4-ylmethyl propanoate has a molecular weight of 172.21 g/mol, XLogP of 0.99, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for thiadiazol-4-ylmethyl propanoate is sourced from PubChem (CID 131211856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).