C23H24F3NO4 — CID 13121204
bis(prop-2-enyl) 1,2,6-trimethyl-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate (PubChem CID 13121204) has the molecular formula C23H24F3NO4 and a molecular weight of 435.44 g/mol. Its IUPAC name is bis(prop-2-enyl) 1,2,6-trimethyl-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate.
| Compound Name | bis(prop-2-enyl) 1,2,6-trimethyl-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 13121204 |
| Molecular Formula | C23H24F3NO4 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | bis(prop-2-enyl) 1,2,6-trimethyl-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate |
| SMILES | C=CCOC(=O)C1=C(C)N(C)C(C)=C(C(=O)OCC=C)C1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H24F3NO4/c1-6-12-30-21(28)18-14(3)27(5)15(4)19(22(29)31-13-7-2)20(18)16-10-8-9-11-17(16)23(24,25)26/h6-11,20H,1-2,12-13H2,3-5H3 |
| InChIKey | YARRRWYFADHPGD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|