About 3-[(1S,2R)-2-chlorocyclohexyl]pentane-2,4-dione
3-[(1S,2R)-2-chlorocyclohexyl]pentane-2,4-dione (PubChem CID 131214336) has the molecular formula C11H17ClO2
and a molecular weight of 216.71 g/mol. Its IUPAC name is 3-[(1S,2R)-2-chlorocyclohexyl]pentane-2,4-dione.
Molecular Properties
| Compound Name | 3-[(1S,2R)-2-chlorocyclohexyl]pentane-2,4-dione |
| PubChem CID | 131214336 |
| Molecular Formula | C11H17ClO2 |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3-[(1S,2R)-2-chlorocyclohexyl]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)[C@@H]1CCCC[C@H]1Cl |
| InChI | InChI=1S/C11H17ClO2/c1-7(13)11(8(2)14)9-5-3-4-6-10(9)12/h9-11H,3-6H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | PVRBKNDLLHIMOX-NXEZZACHSA-N |
| XLogP | 2.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1S,2R)-2-chlorocyclohexyl]pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S,2R)-2-chlorocyclohexyl]pentane-2,4-dione?
The IUPAC name of 3-[(1S,2R)-2-chlorocyclohexyl]pentane-2,4-dione (CID 131214336) is 3-[(1S,2R)-2-chlorocyclohexyl]pentane-2,4-dione.
What is the SMILES notation for 3-[(1S,2R)-2-chlorocyclohexyl]pentane-2,4-dione?
The canonical SMILES for 3-[(1S,2R)-2-chlorocyclohexyl]pentane-2,4-dione is CC(=O)C(C(C)=O)[C@@H]1CCCC[C@H]1Cl.
What is the InChIKey of 3-[(1S,2R)-2-chlorocyclohexyl]pentane-2,4-dione?
The InChIKey is PVRBKNDLLHIMOX-NXEZZACHSA-N. The full InChI is InChI=1S/C11H17ClO2/c1-7(13)11(8(2)14)9-5-3-4-6-10(9)12/h9-11H,3-6H2,1-2H3/t9-,10-/m1/s1.
What are the key properties of 3-[(1S,2R)-2-chlorocyclohexyl]pentane-2,4-dione?
3-[(1S,2R)-2-chlorocyclohexyl]pentane-2,4-dione has a molecular weight of 216.71 g/mol, XLogP of 2.58, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S,2R)-2-chlorocyclohexyl]pentane-2,4-dione is sourced from PubChem (CID 131214336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).