C9H10Cl3NO — CID 131218511
(2R)-2-amino-2-(2,4,6-trichlorophenyl)propan-1-ol (PubChem CID 131218511) has the molecular formula C9H10Cl3NO and a molecular weight of 254.54 g/mol. Its IUPAC name is (2R)-2-amino-2-(2,4,6-trichlorophenyl)propan-1-ol.
| Compound Name | (2R)-2-amino-2-(2,4,6-trichlorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 131218511 |
| Molecular Formula | C9H10Cl3NO |
| Molecular Weight | 254.54 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | (2R)-2-amino-2-(2,4,6-trichlorophenyl)propan-1-ol |
| SMILES | C[C@](N)(CO)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H10Cl3NO/c1-9(13,4-14)8-6(11)2-5(10)3-7(8)12/h2-3,14H,4,13H2,1H3/t9-/m0/s1 |
| InChIKey | ZOSULMDWXIBZOS-VIFPVBQESA-N |
| XLogP | 2.81 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |